C20H20N6O2S2 — CID 73369329
2-(1,3-benzothiazol-2-yl)-6-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione (PubChem CID 73369329) has the molecular formula C20H20N6O2S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-6-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-6-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione |
|---|---|
| PubChem CID | 73369329 |
| Molecular Formula | C20H20N6O2S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-6-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione |
| SMILES | Cc1cc(C)nc(SCC2CC(=O)C3C(=O)N(c4nc5ccccc5s4)NC3N2)n1 |
| InChI | InChI=1S/C20H20N6O2S2/c1-10-7-11(2)22-19(21-10)29-9-12-8-14(27)16-17(23-12)25-26(18(16)28)20-24-13-5-3-4-6-15(13)30-20/h3-7,12,16-17,23,25H,8-9H2,1-2H3 |
| InChIKey | YVWOPOAPZJGWLR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|