C18H18ClN5O2 — CID 73369850
6-(2-chlorophenyl)-2-(4,6-dimethylpyrimidin-2-yl)-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione (PubChem CID 73369850) has the molecular formula C18H18ClN5O2 and a molecular weight of 371.83 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-2-(4,6-dimethylpyrimidin-2-yl)-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione.
| Compound Name | 6-(2-chlorophenyl)-2-(4,6-dimethylpyrimidin-2-yl)-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione |
|---|---|
| PubChem CID | 73369850 |
| Molecular Formula | C18H18ClN5O2 |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 6-(2-chlorophenyl)-2-(4,6-dimethylpyrimidin-2-yl)-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione |
| SMILES | Cc1cc(C)nc(N2NC3NC(c4ccccc4Cl)CC(=O)C3C2=O)n1 |
| InChI | InChI=1S/C18H18ClN5O2/c1-9-7-10(2)21-18(20-9)24-17(26)15-14(25)8-13(22-16(15)23-24)11-5-3-4-6-12(11)19/h3-7,13,15-16,22-23H,8H2,1-2H3 |
| InChIKey | APSDPESRKSBOGI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|