C18H22FN2O2S+ — CID 7337769
[2-[(4R)-4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-(2-methoxyethyl)azanium (PubChem CID 7337769) has the molecular formula C18H22FN2O2S+ and a molecular weight of 349.45 g/mol. Its IUPAC name is [2-[(4R)-4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-(2-methoxyethyl)azanium.
| Compound Name | [2-[(4R)-4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 7337769 |
| Molecular Formula | C18H22FN2O2S+ |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | [2-[(4R)-4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-(2-methoxyethyl)azanium |
| SMILES | COCC[NH2+]CC(=O)N1CCc2sccc2[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H21FN2O2S/c1-23-10-8-20-12-17(22)21-9-6-16-15(7-11-24-16)18(21)13-2-4-14(19)5-3-13/h2-5,7,11,18,20H,6,8-10,12H2,1H3/p+1/t18-/m1/s1 |
| InChIKey | BIRGKNCJWZCCHC-GOSISDBHSA-O |
| XLogP | 1.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|