C21H20N4O — CID 7337977
3-[3-(2-ethyl-6-methylanilino)imidazo[1,2-a]pyrazin-2-yl]phenol (PubChem CID 7337977) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-[3-(2-ethyl-6-methylanilino)imidazo[1,2-a]pyrazin-2-yl]phenol.
| Compound Name | 3-[3-(2-ethyl-6-methylanilino)imidazo[1,2-a]pyrazin-2-yl]phenol |
|---|---|
| PubChem CID | 7337977 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 3-[3-(2-ethyl-6-methylanilino)imidazo[1,2-a]pyrazin-2-yl]phenol |
| SMILES | CCc1cccc(C)c1Nc1c(-c2cccc(O)c2)nc2cnccn12 |
| InChI | InChI=1S/C21H20N4O/c1-3-15-7-4-6-14(2)19(15)24-21-20(16-8-5-9-17(26)12-16)23-18-13-22-10-11-25(18)21/h4-13,24,26H,3H2,1-2H3 |
| InChIKey | CODMSXYOMPDDMC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |