C25H28N4O2 — CID 7338482
(3R)-3-(1,2-dimethylindol-3-yl)-2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3H-isoindol-1-one (PubChem CID 7338482) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is (3R)-3-(1,2-dimethylindol-3-yl)-2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3H-isoindol-1-one.
| Compound Name | (3R)-3-(1,2-dimethylindol-3-yl)-2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 7338482 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (3R)-3-(1,2-dimethylindol-3-yl)-2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3H-isoindol-1-one |
| SMILES | Cc1c([C@H]2c3ccccc3C(=O)N2CC(=O)N2CCN(C)CC2)c2ccccc2n1C |
| InChI | InChI=1S/C25H28N4O2/c1-17-23(20-10-6-7-11-21(20)27(17)3)24-18-8-4-5-9-19(18)25(31)29(24)16-22(30)28-14-12-26(2)13-15-28/h4-11,24H,12-16H2,1-3H3/t24-/m1/s1 |
| InChIKey | AOSFROXALCRYHJ-XMMPIXPASA-N |
| XLogP | 2.81 |
| TPSA | 48.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|