C12H19F3N6O9S — CID 73386743
[(2S,5R)-2-[2-(diaminomethylideneamino)ethoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid (PubChem CID 73386743) has the molecular formula C12H19F3N6O9S and a molecular weight of 480.38 g/mol. Its IUPAC name is [(2S,5R)-2-[2-(diaminomethylideneamino)ethoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid.
| Compound Name | [(2S,5R)-2-[2-(diaminomethylideneamino)ethoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 73386743 |
| Molecular Formula | C12H19F3N6O9S |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | [(2S,5R)-2-[2-(diaminomethylideneamino)ethoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NCCONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H18N6O7S.C2HF3O2/c11-9(12)13-3-4-22-14-8(17)7-2-1-6-5-15(7)10(18)16(6)23-24(19,20)21;3-2(4,5)1(6)7/h6-7H,1-5H2,(H,14,17)(H4,11,12,13)(H,19,20,21);(H,6,7)/t6-,7+;/m1./s1 |
| InChIKey | RUNFOPYGYHSRTC-HHQFNNIRSA-N |
| XLogP | -2.06 |
| TPSA | 227.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|