About 3-chloro-N,N-dimethyl-4-[[5-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]benzamide
3-chloro-N,N-dimethyl-4-[[5-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]benzamide (PubChem CID 73386864) has the molecular formula C22H20ClN5O
and a molecular weight of 405.89 g/mol. Its IUPAC name is 3-chloro-N,N-dimethyl-4-[[5-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]benzamide.
Molecular Properties
| Compound Name | 3-chloro-N,N-dimethyl-4-[[5-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]benzamide |
| PubChem CID | 73386864 |
| Molecular Formula | C22H20ClN5O |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 3-chloro-N,N-dimethyl-4-[[5-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]benzamide |
| SMILES | CN(C)C(=O)c1ccc(Nc2cc3c(-c4cnn(C)c4)cccc3cn2)c(Cl)c1 |
| InChI | InChI=1S/C22H20ClN5O/c1-27(2)22(29)14-7-8-20(19(23)9-14)26-21-10-18-15(11-24-21)5-4-6-17(18)16-12-25-28(3)13-16/h4-13H,1-3H3,(H,24,26) |
| InChIKey | MJFXYHVYPLOYDI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-N,N-dimethyl-4-[[5-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N,N-dimethyl-4-[[5-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]benzamide?
The IUPAC name of 3-chloro-N,N-dimethyl-4-[[5-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]benzamide (CID 73386864) is 3-chloro-N,N-dimethyl-4-[[5-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]benzamide.
What is the SMILES notation for 3-chloro-N,N-dimethyl-4-[[5-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]benzamide?
The canonical SMILES for 3-chloro-N,N-dimethyl-4-[[5-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]benzamide is CN(C)C(=O)c1ccc(Nc2cc3c(-c4cnn(C)c4)cccc3cn2)c(Cl)c1.
What is the InChIKey of 3-chloro-N,N-dimethyl-4-[[5-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]benzamide?
The InChIKey is MJFXYHVYPLOYDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20ClN5O/c1-27(2)22(29)14-7-8-20(19(23)9-14)26-21-10-18-15(11-24-21)5-4-6-17(18)16-12-25-28(3)13-16/h4-13H,1-3H3,(H,24,26).
What are the key properties of 3-chloro-N,N-dimethyl-4-[[5-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]benzamide?
3-chloro-N,N-dimethyl-4-[[5-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]benzamide has a molecular weight of 405.89 g/mol, XLogP of 4.73, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N,N-dimethyl-4-[[5-(1-methylpyrazol-4-yl)isoquinolin-3-yl]amino]benzamide is sourced from PubChem (CID 73386864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).