C36H42N4O4 — CID 73387045
(2S)-2-[(23E)-4,27-dimethyl-26-oxa-1,5,7,8-tetrazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10,12,14(32),15,17,19,23-undecaen-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 73387045) has the molecular formula C36H42N4O4 and a molecular weight of 594.76 g/mol. Its IUPAC name is (2S)-2-[(23E)-4,27-dimethyl-26-oxa-1,5,7,8-tetrazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10,12,14(32),15,17,19,23-undecaen-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | (2S)-2-[(23E)-4,27-dimethyl-26-oxa-1,5,7,8-tetrazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10,12,14(32),15,17,19,23-undecaen-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 73387045 |
| Molecular Formula | C36H42N4O4 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | (2S)-2-[(23E)-4,27-dimethyl-26-oxa-1,5,7,8-tetrazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10,12,14(32),15,17,19,23-undecaen-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | Cc1nc2cc3nn2c(c1[C@H](OC(C)(C)C)C(=O)O)N1CCC(C)(CC1)OC/C=C/CCc1ccccc1-c1cccc-3c1 |
| InChI | InChI=1S/C36H42N4O4/c1-24-31(32(34(41)42)44-35(2,3)4)33-39-19-17-36(5,18-20-39)43-21-10-6-7-12-25-13-8-9-16-28(25)26-14-11-15-27(22-26)29-23-30(37-24)40(33)38-29/h6,8-11,13-16,22-23,32H,7,12,17-21H2,1-5H3,(H,41,42)/b10-6+/t32-/m0/s1 |
| InChIKey | FVXYORBTKDZCDI-LYLASOKRSA-N |
| XLogP | 7.19 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|