C27H35FN4O6S — CID 73387268
S-[(E)-4-[(4Z,7S,10S)-4-ethylidene-17-fluoro-2,5,8,12-tetraoxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] butanethioate (PubChem CID 73387268) has the molecular formula C27H35FN4O6S and a molecular weight of 562.66 g/mol. Its IUPAC name is S-[(E)-4-[(4Z,7S,10S)-4-ethylidene-17-fluoro-2,5,8,12-tetraoxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] butanethioate.
| Compound Name | S-[(E)-4-[(4Z,7S,10S)-4-ethylidene-17-fluoro-2,5,8,12-tetraoxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] butanethioate |
|---|---|
| PubChem CID | 73387268 |
| Molecular Formula | C27H35FN4O6S |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | S-[(E)-4-[(4Z,7S,10S)-4-ethylidene-17-fluoro-2,5,8,12-tetraoxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] butanethioate |
| SMILES | C/C=C1\NC(=O)c2cc(F)cc(n2)CNC(=O)C[C@@H](/C=C/CCSC(=O)CCC)OC(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C27H35FN4O6S/c1-5-9-23(34)39-11-8-7-10-19-14-22(33)29-15-18-12-17(28)13-21(30-18)26(36)31-20(6-2)25(35)32-24(16(3)4)27(37)38-19/h6-7,10,12-13,16,19,24H,5,8-9,11,14-15H2,1-4H3,(H,29,33)(H,31,36)(H,32,35)/b10-7+,20-6-/t19-,24+/m1/s1 |
| InChIKey | IXUICBHUSWZGTR-SNVPDBIFSA-N |
| XLogP | 2.93 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|