About 5-[2-(2-ethyl-4-fluorophenyl)-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one
5-[2-(2-ethyl-4-fluorophenyl)-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 73387297) has the molecular formula C18H14FN3OS
and a molecular weight of 339.40 g/mol. Its IUPAC name is 5-[2-(2-ethyl-4-fluorophenyl)-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one.
Molecular Properties
| Compound Name | 5-[2-(2-ethyl-4-fluorophenyl)-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one |
| PubChem CID | 73387297 |
| Molecular Formula | C18H14FN3OS |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 5-[2-(2-ethyl-4-fluorophenyl)-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | CCc1cc(F)ccc1-c1nc(-c2ccc3[nH]c(=O)[nH]c3c2)cs1 |
| InChI | InChI=1S/C18H14FN3OS/c1-2-10-7-12(19)4-5-13(10)17-20-16(9-24-17)11-3-6-14-15(8-11)22-18(23)21-14/h3-9H,2H2,1H3,(H2,21,22,23) |
| InChIKey | DLRSVBGOGOGZLU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2-(2-ethyl-4-fluorophenyl)-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2-ethyl-4-fluorophenyl)-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one?
The IUPAC name of 5-[2-(2-ethyl-4-fluorophenyl)-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one (CID 73387297) is 5-[2-(2-ethyl-4-fluorophenyl)-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one.
What is the SMILES notation for 5-[2-(2-ethyl-4-fluorophenyl)-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one?
The canonical SMILES for 5-[2-(2-ethyl-4-fluorophenyl)-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one is CCc1cc(F)ccc1-c1nc(-c2ccc3[nH]c(=O)[nH]c3c2)cs1.
What is the InChIKey of 5-[2-(2-ethyl-4-fluorophenyl)-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one?
The InChIKey is DLRSVBGOGOGZLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14FN3OS/c1-2-10-7-12(19)4-5-13(10)17-20-16(9-24-17)11-3-6-14-15(8-11)22-18(23)21-14/h3-9H,2H2,1H3,(H2,21,22,23).
What are the key properties of 5-[2-(2-ethyl-4-fluorophenyl)-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one?
5-[2-(2-ethyl-4-fluorophenyl)-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one has a molecular weight of 339.40 g/mol, XLogP of 4.35, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2-ethyl-4-fluorophenyl)-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one is sourced from PubChem (CID 73387297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).