C20H26N4O2S — CID 73387603
4-[(4-cyclohexylpiperazin-1-yl)methyl]-2-(2-nitrophenyl)-1,3-thiazole (PubChem CID 73387603) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is 4-[(4-cyclohexylpiperazin-1-yl)methyl]-2-(2-nitrophenyl)-1,3-thiazole.
| Compound Name | 4-[(4-cyclohexylpiperazin-1-yl)methyl]-2-(2-nitrophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 73387603 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 4-[(4-cyclohexylpiperazin-1-yl)methyl]-2-(2-nitrophenyl)-1,3-thiazole |
| SMILES | O=[N+]([O-])c1ccccc1-c1nc(CN2CCN(C3CCCCC3)CC2)cs1 |
| InChI | InChI=1S/C20H26N4O2S/c25-24(26)19-9-5-4-8-18(19)20-21-16(15-27-20)14-22-10-12-23(13-11-22)17-6-2-1-3-7-17/h4-5,8-9,15,17H,1-3,6-7,10-14H2 |
| InChIKey | MBKOUFWQFDSDSM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|