C13H22N2O3 — CID 73387637
N-[(3S,4R,5S)-4-hydroxy-5-(hydroxymethyl)-1-pent-4-ynylpyrrolidin-3-yl]propanamide (PubChem CID 73387637) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is N-[(3S,4R,5S)-4-hydroxy-5-(hydroxymethyl)-1-pent-4-ynylpyrrolidin-3-yl]propanamide.
| Compound Name | N-[(3S,4R,5S)-4-hydroxy-5-(hydroxymethyl)-1-pent-4-ynylpyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 73387637 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N-[(3S,4R,5S)-4-hydroxy-5-(hydroxymethyl)-1-pent-4-ynylpyrrolidin-3-yl]propanamide |
| SMILES | C#CCCCN1C[C@H](NC(=O)CC)[C@@H](O)[C@@H]1CO |
| InChI | InChI=1S/C13H22N2O3/c1-3-5-6-7-15-8-10(14-12(17)4-2)13(18)11(15)9-16/h1,10-11,13,16,18H,4-9H2,2H3,(H,14,17)/t10-,11-,13+/m0/s1 |
| InChIKey | BEDHZCCCDIFJPT-GMXVVIOVSA-N |
| XLogP | -0.67 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|