C37H52N2O4 — CID 73387682
(2S,4aS,6aS,6bR,8aR,12aS,14aS,14bR)-11-cyano-N-cyclohexyl-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide (PubChem CID 73387682) has the molecular formula C37H52N2O4 and a molecular weight of 588.83 g/mol. Its IUPAC name is (2S,4aS,6aS,6bR,8aR,12aS,14aS,14bR)-11-cyano-N-cyclohexyl-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide.
| Compound Name | (2S,4aS,6aS,6bR,8aR,12aS,14aS,14bR)-11-cyano-N-cyclohexyl-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 73387682 |
| Molecular Formula | C37H52N2O4 |
| Molecular Weight | 588.83 g/mol |
| Exact Mass | 588.39 |
| IUPAC Name | (2S,4aS,6aS,6bR,8aR,12aS,14aS,14bR)-11-cyano-N-cyclohexyl-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@]2(C)C3=CC(=O)[C@]4(O)[C@@H]5C[C@@](C)(C(=O)NC6CCCCC6)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C37H52N2O4/c1-31(2)25-13-14-35(6)26(34(25,5)20-23(22-38)29(31)41)19-28(40)37(43)27-21-33(4,30(42)39-24-11-9-8-10-12-24)16-15-32(27,3)17-18-36(35,37)7/h19-20,24-25,27,43H,8-18,21H2,1-7H3,(H,39,42)/t25-,27+,32+,33-,34-,35+,36-,37+/m0/s1 |
| InChIKey | GDQOZNAABXAAEU-SPYCNQHCSA-N |
| XLogP | 6.77 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.83 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |