About 1-(2-chlorophenyl)-8-fluoro-6-methoxy-3-methylpyrazolo[3,4-c]cinnoline
1-(2-chlorophenyl)-8-fluoro-6-methoxy-3-methylpyrazolo[3,4-c]cinnoline (PubChem CID 73387745) has the molecular formula C17H12ClFN4O
and a molecular weight of 342.76 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-8-fluoro-6-methoxy-3-methylpyrazolo[3,4-c]cinnoline.
Molecular Properties
| Compound Name | 1-(2-chlorophenyl)-8-fluoro-6-methoxy-3-methylpyrazolo[3,4-c]cinnoline |
| PubChem CID | 73387745 |
| Molecular Formula | C17H12ClFN4O |
| Molecular Weight | 342.76 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-(2-chlorophenyl)-8-fluoro-6-methoxy-3-methylpyrazolo[3,4-c]cinnoline |
| SMILES | COc1cc(F)cc2c1nnc1c2c(-c2ccccc2Cl)nn1C |
| InChI | InChI=1S/C17H12ClFN4O/c1-23-17-14(16(22-23)10-5-3-4-6-12(10)18)11-7-9(19)8-13(24-2)15(11)20-21-17/h3-8H,1-2H3 |
| InChIKey | MMJDOWOZKGXPBB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.76 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-chlorophenyl)-8-fluoro-6-methoxy-3-methylpyrazolo[3,4-c]cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorophenyl)-8-fluoro-6-methoxy-3-methylpyrazolo[3,4-c]cinnoline?
The IUPAC name of 1-(2-chlorophenyl)-8-fluoro-6-methoxy-3-methylpyrazolo[3,4-c]cinnoline (CID 73387745) is 1-(2-chlorophenyl)-8-fluoro-6-methoxy-3-methylpyrazolo[3,4-c]cinnoline.
What is the SMILES notation for 1-(2-chlorophenyl)-8-fluoro-6-methoxy-3-methylpyrazolo[3,4-c]cinnoline?
The canonical SMILES for 1-(2-chlorophenyl)-8-fluoro-6-methoxy-3-methylpyrazolo[3,4-c]cinnoline is COc1cc(F)cc2c1nnc1c2c(-c2ccccc2Cl)nn1C.
What is the InChIKey of 1-(2-chlorophenyl)-8-fluoro-6-methoxy-3-methylpyrazolo[3,4-c]cinnoline?
The InChIKey is MMJDOWOZKGXPBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12ClFN4O/c1-23-17-14(16(22-23)10-5-3-4-6-12(10)18)11-7-9(19)8-13(24-2)15(11)20-21-17/h3-8H,1-2H3.
What are the key properties of 1-(2-chlorophenyl)-8-fluoro-6-methoxy-3-methylpyrazolo[3,4-c]cinnoline?
1-(2-chlorophenyl)-8-fluoro-6-methoxy-3-methylpyrazolo[3,4-c]cinnoline has a molecular weight of 342.76 g/mol, XLogP of 3.98, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenyl)-8-fluoro-6-methoxy-3-methylpyrazolo[3,4-c]cinnoline is sourced from PubChem (CID 73387745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).