C19H14Cl3N3O2 — CID 73387943
1-[(4-pyridin-4-yloxyphenyl)methyl]-3-(2,4,5-trichlorophenyl)urea (PubChem CID 73387943) has the molecular formula C19H14Cl3N3O2 and a molecular weight of 422.70 g/mol. Its IUPAC name is 1-[(4-pyridin-4-yloxyphenyl)methyl]-3-(2,4,5-trichlorophenyl)urea.
| Compound Name | 1-[(4-pyridin-4-yloxyphenyl)methyl]-3-(2,4,5-trichlorophenyl)urea |
|---|---|
| PubChem CID | 73387943 |
| Molecular Formula | C19H14Cl3N3O2 |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 1-[(4-pyridin-4-yloxyphenyl)methyl]-3-(2,4,5-trichlorophenyl)urea |
| SMILES | O=C(NCc1ccc(Oc2ccncc2)cc1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H14Cl3N3O2/c20-15-9-17(22)18(10-16(15)21)25-19(26)24-11-12-1-3-13(4-2-12)27-14-5-7-23-8-6-14/h1-10H,11H2,(H2,24,25,26) |
| InChIKey | ZAKIYVLPSBVIDX-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|