About 1,6,8-trimethoxy-3-methylpyrazolo[3,4-c]cinnoline
1,6,8-trimethoxy-3-methylpyrazolo[3,4-c]cinnoline (PubChem CID 73387956) has the molecular formula C13H14N4O3
and a molecular weight of 274.28 g/mol. Its IUPAC name is 1,6,8-trimethoxy-3-methylpyrazolo[3,4-c]cinnoline.
Molecular Properties
| Compound Name | 1,6,8-trimethoxy-3-methylpyrazolo[3,4-c]cinnoline |
| PubChem CID | 73387956 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1,6,8-trimethoxy-3-methylpyrazolo[3,4-c]cinnoline |
| SMILES | COc1cc(OC)c2nnc3c(c(OC)nn3C)c2c1 |
| InChI | InChI=1S/C13H14N4O3/c1-17-12-10(13(16-17)20-4)8-5-7(18-2)6-9(19-3)11(8)14-15-12/h5-6H,1-4H3 |
| InChIKey | LKWUNSBKNMTAPZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,6,8-trimethoxy-3-methylpyrazolo[3,4-c]cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6,8-trimethoxy-3-methylpyrazolo[3,4-c]cinnoline?
The IUPAC name of 1,6,8-trimethoxy-3-methylpyrazolo[3,4-c]cinnoline (CID 73387956) is 1,6,8-trimethoxy-3-methylpyrazolo[3,4-c]cinnoline.
What is the SMILES notation for 1,6,8-trimethoxy-3-methylpyrazolo[3,4-c]cinnoline?
The canonical SMILES for 1,6,8-trimethoxy-3-methylpyrazolo[3,4-c]cinnoline is COc1cc(OC)c2nnc3c(c(OC)nn3C)c2c1.
What is the InChIKey of 1,6,8-trimethoxy-3-methylpyrazolo[3,4-c]cinnoline?
The InChIKey is LKWUNSBKNMTAPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O3/c1-17-12-10(13(16-17)20-4)8-5-7(18-2)6-9(19-3)11(8)14-15-12/h5-6H,1-4H3.
What are the key properties of 1,6,8-trimethoxy-3-methylpyrazolo[3,4-c]cinnoline?
1,6,8-trimethoxy-3-methylpyrazolo[3,4-c]cinnoline has a molecular weight of 274.28 g/mol, XLogP of 1.54, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6,8-trimethoxy-3-methylpyrazolo[3,4-c]cinnoline is sourced from PubChem (CID 73387956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).