C17H22F2N2OS — CID 73388368
(4aR,6S,8aS)-8a-(2,4-difluorophenyl)-6-(2-methylpropyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 73388368) has the molecular formula C17H22F2N2OS and a molecular weight of 340.44 g/mol. Its IUPAC name is (4aR,6S,8aS)-8a-(2,4-difluorophenyl)-6-(2-methylpropyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,6S,8aS)-8a-(2,4-difluorophenyl)-6-(2-methylpropyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 73388368 |
| Molecular Formula | C17H22F2N2OS |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (4aR,6S,8aS)-8a-(2,4-difluorophenyl)-6-(2-methylpropyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | CC(C)C[C@H]1C[C@H]2CSC(N)=N[C@@]2(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C17H22F2N2OS/c1-10(2)5-13-6-11-8-23-16(20)21-17(11,9-22-13)14-4-3-12(18)7-15(14)19/h3-4,7,10-11,13H,5-6,8-9H2,1-2H3,(H2,20,21)/t11-,13-,17-/m0/s1 |
| InChIKey | KSUADMBOPPDFIC-BNLOLNQZSA-N |
| XLogP | 3.67 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |