About 5-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-3-(4-methoxyphenyl)-1,2-oxazole
5-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-3-(4-methoxyphenyl)-1,2-oxazole (PubChem CID 73388399) has the molecular formula C19H17N3O3S
and a molecular weight of 367.43 g/mol. Its IUPAC name is 5-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-3-(4-methoxyphenyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-3-(4-methoxyphenyl)-1,2-oxazole |
| PubChem CID | 73388399 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 5-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-3-(4-methoxyphenyl)-1,2-oxazole |
| SMILES | CCc1cc2c(OCc3cc(-c4ccc(OC)cc4)no3)ncnc2s1 |
| InChI | InChI=1S/C19H17N3O3S/c1-3-15-9-16-18(20-11-21-19(16)26-15)24-10-14-8-17(22-25-14)12-4-6-13(23-2)7-5-12/h4-9,11H,3,10H2,1-2H3 |
| InChIKey | XMGOARFZLUMZSB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 70.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-3-(4-methoxyphenyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-3-(4-methoxyphenyl)-1,2-oxazole?
The IUPAC name of 5-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-3-(4-methoxyphenyl)-1,2-oxazole (CID 73388399) is 5-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-3-(4-methoxyphenyl)-1,2-oxazole.
What is the SMILES notation for 5-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-3-(4-methoxyphenyl)-1,2-oxazole?
The canonical SMILES for 5-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-3-(4-methoxyphenyl)-1,2-oxazole is CCc1cc2c(OCc3cc(-c4ccc(OC)cc4)no3)ncnc2s1.
What is the InChIKey of 5-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-3-(4-methoxyphenyl)-1,2-oxazole?
The InChIKey is XMGOARFZLUMZSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O3S/c1-3-15-9-16-18(20-11-21-19(16)26-15)24-10-14-8-17(22-25-14)12-4-6-13(23-2)7-5-12/h4-9,11H,3,10H2,1-2H3.
What are the key properties of 5-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-3-(4-methoxyphenyl)-1,2-oxazole?
5-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-3-(4-methoxyphenyl)-1,2-oxazole has a molecular weight of 367.43 g/mol, XLogP of 4.50, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-3-(4-methoxyphenyl)-1,2-oxazole is sourced from PubChem (CID 73388399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).