C20H24O3 — CID 73388777
2-(11-hydroxyundeca-5,8-diynyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 73388777) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-(11-hydroxyundeca-5,8-diynyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(11-hydroxyundeca-5,8-diynyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 73388777 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-(11-hydroxyundeca-5,8-diynyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(CCCCC#CCC#CCCO)=C(C)C1=O |
| InChI | InChI=1S/C20H24O3/c1-15-16(2)20(23)18(17(3)19(15)22)13-11-9-7-5-4-6-8-10-12-14-21/h21H,6-7,9,11-14H2,1-3H3 |
| InChIKey | SWNANEREBNQAHT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|