About [2-(dimethylcarbamothioylsulfanylmethyl)-3-oxo-3-(1,3-thiazol-2-yl)propyl] N,N-dimethylcarbamodithioate
[2-(dimethylcarbamothioylsulfanylmethyl)-3-oxo-3-(1,3-thiazol-2-yl)propyl] N,N-dimethylcarbamodithioate (PubChem CID 73388875) has the molecular formula C13H19N3OS5
and a molecular weight of 393.65 g/mol. Its IUPAC name is [2-(dimethylcarbamothioylsulfanylmethyl)-3-oxo-3-(1,3-thiazol-2-yl)propyl] N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | [2-(dimethylcarbamothioylsulfanylmethyl)-3-oxo-3-(1,3-thiazol-2-yl)propyl] N,N-dimethylcarbamodithioate |
| PubChem CID | 73388875 |
| Molecular Formula | C13H19N3OS5 |
| Molecular Weight | 393.65 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | [2-(dimethylcarbamothioylsulfanylmethyl)-3-oxo-3-(1,3-thiazol-2-yl)propyl] N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)SCC(CSC(=S)N(C)C)C(=O)c1nccs1 |
| InChI | InChI=1S/C13H19N3OS5/c1-15(2)12(18)21-7-9(8-22-13(19)16(3)4)10(17)11-14-5-6-20-11/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | ADTVTWPIWAPEQH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.65 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [2-(dimethylcarbamothioylsulfanylmethyl)-3-oxo-3-(1,3-thiazol-2-yl)propyl] N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(dimethylcarbamothioylsulfanylmethyl)-3-oxo-3-(1,3-thiazol-2-yl)propyl] N,N-dimethylcarbamodithioate?
The IUPAC name of [2-(dimethylcarbamothioylsulfanylmethyl)-3-oxo-3-(1,3-thiazol-2-yl)propyl] N,N-dimethylcarbamodithioate (CID 73388875) is [2-(dimethylcarbamothioylsulfanylmethyl)-3-oxo-3-(1,3-thiazol-2-yl)propyl] N,N-dimethylcarbamodithioate.
What is the SMILES notation for [2-(dimethylcarbamothioylsulfanylmethyl)-3-oxo-3-(1,3-thiazol-2-yl)propyl] N,N-dimethylcarbamodithioate?
The canonical SMILES for [2-(dimethylcarbamothioylsulfanylmethyl)-3-oxo-3-(1,3-thiazol-2-yl)propyl] N,N-dimethylcarbamodithioate is CN(C)C(=S)SCC(CSC(=S)N(C)C)C(=O)c1nccs1.
What is the InChIKey of [2-(dimethylcarbamothioylsulfanylmethyl)-3-oxo-3-(1,3-thiazol-2-yl)propyl] N,N-dimethylcarbamodithioate?
The InChIKey is ADTVTWPIWAPEQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3OS5/c1-15(2)12(18)21-7-9(8-22-13(19)16(3)4)10(17)11-14-5-6-20-11/h5-6,9H,7-8H2,1-4H3.
What are the key properties of [2-(dimethylcarbamothioylsulfanylmethyl)-3-oxo-3-(1,3-thiazol-2-yl)propyl] N,N-dimethylcarbamodithioate?
[2-(dimethylcarbamothioylsulfanylmethyl)-3-oxo-3-(1,3-thiazol-2-yl)propyl] N,N-dimethylcarbamodithioate has a molecular weight of 393.65 g/mol, XLogP of 3.10, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(dimethylcarbamothioylsulfanylmethyl)-3-oxo-3-(1,3-thiazol-2-yl)propyl] N,N-dimethylcarbamodithioate is sourced from PubChem (CID 73388875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).