About 1-[3-[4-(benzylamino)-2,1,3-benzoxadiazol-6-yl]phenyl]ethanol
1-[3-[4-(benzylamino)-2,1,3-benzoxadiazol-6-yl]phenyl]ethanol (PubChem CID 73388993) has the molecular formula C21H19N3O2
and a molecular weight of 345.40 g/mol. Its IUPAC name is 1-[3-[4-(benzylamino)-2,1,3-benzoxadiazol-6-yl]phenyl]ethanol.
Molecular Properties
| Compound Name | 1-[3-[4-(benzylamino)-2,1,3-benzoxadiazol-6-yl]phenyl]ethanol |
| PubChem CID | 73388993 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1-[3-[4-(benzylamino)-2,1,3-benzoxadiazol-6-yl]phenyl]ethanol |
| SMILES | CC(O)c1cccc(-c2cc(NCc3ccccc3)c3nonc3c2)c1 |
| InChI | InChI=1S/C21H19N3O2/c1-14(25)16-8-5-9-17(10-16)18-11-19(21-20(12-18)23-26-24-21)22-13-15-6-3-2-4-7-15/h2-12,14,22,25H,13H2,1H3 |
| InChIKey | PNEGAQCZCNAMNT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-[4-(benzylamino)-2,1,3-benzoxadiazol-6-yl]phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[4-(benzylamino)-2,1,3-benzoxadiazol-6-yl]phenyl]ethanol?
The IUPAC name of 1-[3-[4-(benzylamino)-2,1,3-benzoxadiazol-6-yl]phenyl]ethanol (CID 73388993) is 1-[3-[4-(benzylamino)-2,1,3-benzoxadiazol-6-yl]phenyl]ethanol.
What is the SMILES notation for 1-[3-[4-(benzylamino)-2,1,3-benzoxadiazol-6-yl]phenyl]ethanol?
The canonical SMILES for 1-[3-[4-(benzylamino)-2,1,3-benzoxadiazol-6-yl]phenyl]ethanol is CC(O)c1cccc(-c2cc(NCc3ccccc3)c3nonc3c2)c1.
What is the InChIKey of 1-[3-[4-(benzylamino)-2,1,3-benzoxadiazol-6-yl]phenyl]ethanol?
The InChIKey is PNEGAQCZCNAMNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O2/c1-14(25)16-8-5-9-17(10-16)18-11-19(21-20(12-18)23-26-24-21)22-13-15-6-3-2-4-7-15/h2-12,14,22,25H,13H2,1H3.
What are the key properties of 1-[3-[4-(benzylamino)-2,1,3-benzoxadiazol-6-yl]phenyl]ethanol?
1-[3-[4-(benzylamino)-2,1,3-benzoxadiazol-6-yl]phenyl]ethanol has a molecular weight of 345.40 g/mol, XLogP of 4.56, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[4-(benzylamino)-2,1,3-benzoxadiazol-6-yl]phenyl]ethanol is sourced from PubChem (CID 73388993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).