About N-(cyclohexylmethyl)-3-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanamide
N-(cyclohexylmethyl)-3-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanamide (PubChem CID 73389739) has the molecular formula C17H26N5O3+
and a molecular weight of 348.43 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-3-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanamide.
Molecular Properties
| Compound Name | N-(cyclohexylmethyl)-3-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanamide |
| PubChem CID | 73389739 |
| Molecular Formula | C17H26N5O3+ |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-(cyclohexylmethyl)-3-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanamide |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CCC(=O)NCC2CCCCC2)N(C)C1=O |
| InChI | InChI=1S/C17H25N5O3/c1-20-15-14(16(24)21(2)17(20)25)22(11-19-15)9-8-13(23)18-10-12-6-4-3-5-7-12/h11-12,14H,3-10H2,1-2H3/p+1 |
| InChIKey | AFTIZWMEDBKCTM-UHFFFAOYSA-O |
| XLogP | 0.42 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclohexylmethyl)-3-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexylmethyl)-3-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanamide?
The IUPAC name of N-(cyclohexylmethyl)-3-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanamide (CID 73389739) is N-(cyclohexylmethyl)-3-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanamide.
What is the SMILES notation for N-(cyclohexylmethyl)-3-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanamide?
The canonical SMILES for N-(cyclohexylmethyl)-3-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanamide is CN1C(=O)C2C(=NC=[N+]2CCC(=O)NCC2CCCCC2)N(C)C1=O.
What is the InChIKey of N-(cyclohexylmethyl)-3-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanamide?
The InChIKey is AFTIZWMEDBKCTM-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H25N5O3/c1-20-15-14(16(24)21(2)17(20)25)22(11-19-15)9-8-13(23)18-10-12-6-4-3-5-7-12/h11-12,14H,3-10H2,1-2H3/p+1.
What are the key properties of N-(cyclohexylmethyl)-3-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanamide?
N-(cyclohexylmethyl)-3-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanamide has a molecular weight of 348.43 g/mol, XLogP of 0.42, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexylmethyl)-3-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanamide is sourced from PubChem (CID 73389739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).