About (3-bromophenyl)methyl 2-benzamidoacetate
(3-bromophenyl)methyl 2-benzamidoacetate (PubChem CID 733925) has the molecular formula C16H14BrNO3
and a molecular weight of 348.20 g/mol. Its IUPAC name is (3-bromophenyl)methyl 2-benzamidoacetate.
Molecular Properties
| Compound Name | (3-bromophenyl)methyl 2-benzamidoacetate |
| PubChem CID | 733925 |
| Molecular Formula | C16H14BrNO3 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | (3-bromophenyl)methyl 2-benzamidoacetate |
| SMILES | O=C(CNC(=O)c1ccccc1)OCc1cccc(Br)c1 |
| InChI | InChI=1S/C16H14BrNO3/c17-14-8-4-5-12(9-14)11-21-15(19)10-18-16(20)13-6-2-1-3-7-13/h1-9H,10-11H2,(H,18,20) |
| InChIKey | UZAFETZFNNOCSO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-bromophenyl)methyl 2-benzamidoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl)methyl 2-benzamidoacetate?
The IUPAC name of (3-bromophenyl)methyl 2-benzamidoacetate (CID 733925) is (3-bromophenyl)methyl 2-benzamidoacetate.
What is the SMILES notation for (3-bromophenyl)methyl 2-benzamidoacetate?
The canonical SMILES for (3-bromophenyl)methyl 2-benzamidoacetate is O=C(CNC(=O)c1ccccc1)OCc1cccc(Br)c1.
What is the InChIKey of (3-bromophenyl)methyl 2-benzamidoacetate?
The InChIKey is UZAFETZFNNOCSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrNO3/c17-14-8-4-5-12(9-14)11-21-15(19)10-18-16(20)13-6-2-1-3-7-13/h1-9H,10-11H2,(H,18,20).
What are the key properties of (3-bromophenyl)methyl 2-benzamidoacetate?
(3-bromophenyl)methyl 2-benzamidoacetate has a molecular weight of 348.20 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)methyl 2-benzamidoacetate is sourced from PubChem (CID 733925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).