C11H15N4O3+ — CID 73395350
1,3-dimethyl-4-morpholin-4-ium-4-ylidene-2,6-dioxo-1,3-diazinane-5-carbonitrile (PubChem CID 73395350) has the molecular formula C11H15N4O3+ and a molecular weight of 251.27 g/mol. Its IUPAC name is 1,3-dimethyl-4-morpholin-4-ium-4-ylidene-2,6-dioxo-1,3-diazinane-5-carbonitrile.
| Compound Name | 1,3-dimethyl-4-morpholin-4-ium-4-ylidene-2,6-dioxo-1,3-diazinane-5-carbonitrile |
|---|---|
| PubChem CID | 73395350 |
| Molecular Formula | C11H15N4O3+ |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1,3-dimethyl-4-morpholin-4-ium-4-ylidene-2,6-dioxo-1,3-diazinane-5-carbonitrile |
| SMILES | CN1C(=O)C(C#N)C(=[N+]2CCOCC2)N(C)C1=O |
| InChI | InChI=1S/C11H15N4O3/c1-13-9(15-3-5-18-6-4-15)8(7-12)10(16)14(2)11(13)17/h8H,3-6H2,1-2H3/q+1 |
| InChIKey | OPPHVOFRJDRUGN-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 76.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|