C19H23N3OS — CID 7339705
5-(3-methoxypropyl)-1,3-diphenyl-1,3,5-triazinane-2-thione (PubChem CID 7339705) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is 5-(3-methoxypropyl)-1,3-diphenyl-1,3,5-triazinane-2-thione.
| Compound Name | 5-(3-methoxypropyl)-1,3-diphenyl-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 7339705 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 5-(3-methoxypropyl)-1,3-diphenyl-1,3,5-triazinane-2-thione |
| SMILES | COCCCN1CN(c2ccccc2)C(=S)N(c2ccccc2)C1 |
| InChI | InChI=1S/C19H23N3OS/c1-23-14-8-13-20-15-21(17-9-4-2-5-10-17)19(24)22(16-20)18-11-6-3-7-12-18/h2-7,9-12H,8,13-16H2,1H3 |
| InChIKey | VSQTVJGGBWFPJM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|