C22H20N4O6 — CID 73399671
(2,5-dioxopyrrolidin-1-yl) 2-[(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)amino]-3-phenylpropanoate (PubChem CID 73399671) has the molecular formula C22H20N4O6 and a molecular weight of 436.42 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)amino]-3-phenylpropanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 73399671 |
| Molecular Formula | C22H20N4O6 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)amino]-3-phenylpropanoate |
| SMILES | O=C1CN(C(=O)NC(Cc2ccccc2)C(=O)ON2C(=O)CCC2=O)c2ccccc2N1 |
| InChI | InChI=1S/C22H20N4O6/c27-18-13-25(17-9-5-4-8-15(17)23-18)22(31)24-16(12-14-6-2-1-3-7-14)21(30)32-26-19(28)10-11-20(26)29/h1-9,16H,10-13H2,(H,23,27)(H,24,31) |
| InChIKey | NNXQLLOMJWSZMJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|