C28H24ClN3O4 — CID 73400448
1-[(4-chlorophenyl)-hydroxymethyl]-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 73400448) has the molecular formula C28H24ClN3O4 and a molecular weight of 501.97 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-hydroxymethyl]-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | 1-[(4-chlorophenyl)-hydroxymethyl]-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 73400448 |
| Molecular Formula | C28H24ClN3O4 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 1-[(4-chlorophenyl)-hydroxymethyl]-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | O=C1C2C(C(O)c3ccc(Cl)cc3)NC3(C(=O)Nc4ccccc43)C2C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C28H24ClN3O4/c29-18-12-10-17(11-13-18)24(33)23-21-22(28(31-23)19-8-4-5-9-20(19)30-27(28)36)26(35)32(25(21)34)15-14-16-6-2-1-3-7-16/h1-13,21-24,31,33H,14-15H2,(H,30,36) |
| InChIKey | GBUPVDBJOJQTGR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|