C8H16N2O — CID 7340156
(NE)-N-[(2R,5R)-1,2,5-trimethylpiperidin-4-ylidene]hydroxylamine (PubChem CID 7340156) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is (NE)-N-[(2R,5R)-1,2,5-trimethylpiperidin-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2R,5R)-1,2,5-trimethylpiperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 7340156 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (NE)-N-[(2R,5R)-1,2,5-trimethylpiperidin-4-ylidene]hydroxylamine |
| SMILES | C[C@@H]1CN(C)[C@H](C)C/C1=N\O |
| InChI | InChI=1S/C8H16N2O/c1-6-5-10(3)7(2)4-8(6)9-11/h6-7,11H,4-5H2,1-3H3/b9-8+/t6-,7-/m1/s1 |
| InChIKey | ONKISBIHPDPWJL-GEWYRVSKSA-N |
| XLogP | 1.18 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|