C11H14N6O — CID 7340169
N-[(E)-1-(1,3-dimethylpyrazol-4-yl)ethylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 7340169) has the molecular formula C11H14N6O and a molecular weight of 246.27 g/mol. Its IUPAC name is N-[(E)-1-(1,3-dimethylpyrazol-4-yl)ethylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(E)-1-(1,3-dimethylpyrazol-4-yl)ethylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 7340169 |
| Molecular Formula | C11H14N6O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-[(E)-1-(1,3-dimethylpyrazol-4-yl)ethylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | C/C(=N\NC(=O)c1ccn[nH]1)c1cn(C)nc1C |
| InChI | InChI=1S/C11H14N6O/c1-7(9-6-17(3)16-8(9)2)13-15-11(18)10-4-5-12-14-10/h4-6H,1-3H3,(H,12,14)(H,15,18)/b13-7+ |
| InChIKey | SGUSESXGPKQIMC-NTUHNPAUSA-N |
| XLogP | 0.61 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|