C25H35NO5 — CID 73401798
3-(3,4-dimethoxyphenyl)-7-[2-(4-methylpiperidin-1-yl)ethoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 73401798) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-7-[2-(4-methylpiperidin-1-yl)ethoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-7-[2-(4-methylpiperidin-1-yl)ethoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 73401798 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-7-[2-(4-methylpiperidin-1-yl)ethoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | COc1ccc(C2=COC3CC(OCCN4CCC(C)CC4)CCC3C2=O)cc1OC |
| InChI | InChI=1S/C25H35NO5/c1-17-8-10-26(11-9-17)12-13-30-19-5-6-20-23(15-19)31-16-21(25(20)27)18-4-7-22(28-2)24(14-18)29-3/h4,7,14,16-17,19-20,23H,5-6,8-13,15H2,1-3H3 |
| InChIKey | SRVMGWRNUPXIRA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |