C26H31N3O — CID 73407656
10a-[4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-7,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one (PubChem CID 73407656) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is 10a-[4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-7,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one.
| Compound Name | 10a-[4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-7,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one |
|---|---|
| PubChem CID | 73407656 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 10a-[4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-7,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one |
| SMILES | Cc1ccc2c(c1)N1CCC(=O)NC1(C=CC=Cc1ccc(N(C)C)cc1)C2(C)C |
| InChI | InChI=1S/C26H31N3O/c1-19-9-14-22-23(18-19)29-17-15-24(30)27-26(29,25(22,2)3)16-7-6-8-20-10-12-21(13-11-20)28(4)5/h6-14,16,18H,15,17H2,1-5H3,(H,27,30) |
| InChIKey | NIGJVUTUUYFVFG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|