C23H28O10 — CID 73407836
pentamethyl 5-methyl-1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,4,7,7-pentacarboxylate (PubChem CID 73407836) has the molecular formula C23H28O10 and a molecular weight of 464.47 g/mol. Its IUPAC name is pentamethyl 5-methyl-1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,4,7,7-pentacarboxylate.
| Compound Name | pentamethyl 5-methyl-1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,4,7,7-pentacarboxylate |
|---|---|
| PubChem CID | 73407836 |
| Molecular Formula | C23H28O10 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | pentamethyl 5-methyl-1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,4,7,7-pentacarboxylate |
| SMILES | COC(=O)C1=C2CC(C(=O)OC)(C(=O)OC)CC2C2CC(C(=O)OC)(C(=O)OC)CC2=C1C |
| InChI | InChI=1S/C23H28O10/c1-11-12-7-22(18(25)30-3,19(26)31-4)8-13(12)14-9-23(20(27)32-5,21(28)33-6)10-15(14)16(11)17(24)29-2/h13-14H,7-10H2,1-6H3 |
| InChIKey | USXOHVVWKVWLHX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|