C25H29NO8S — CID 73407879
trimethyl 4-methyl-2-(4-methylphenyl)sulfonyl-1,3,6,8,8a,8b-hexahydrocyclopenta[e]isoindole-5,7,7-tricarboxylate (PubChem CID 73407879) has the molecular formula C25H29NO8S and a molecular weight of 503.57 g/mol. Its IUPAC name is trimethyl 4-methyl-2-(4-methylphenyl)sulfonyl-1,3,6,8,8a,8b-hexahydrocyclopenta[e]isoindole-5,7,7-tricarboxylate.
| Compound Name | trimethyl 4-methyl-2-(4-methylphenyl)sulfonyl-1,3,6,8,8a,8b-hexahydrocyclopenta[e]isoindole-5,7,7-tricarboxylate |
|---|---|
| PubChem CID | 73407879 |
| Molecular Formula | C25H29NO8S |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | trimethyl 4-methyl-2-(4-methylphenyl)sulfonyl-1,3,6,8,8a,8b-hexahydrocyclopenta[e]isoindole-5,7,7-tricarboxylate |
| SMILES | COC(=O)C1=C2CC(C(=O)OC)(C(=O)OC)CC2C2CN(S(=O)(=O)c3ccc(C)cc3)CC2=C1C |
| InChI | InChI=1S/C25H29NO8S/c1-14-6-8-16(9-7-14)35(30,31)26-12-19-15(2)21(22(27)32-3)18-11-25(23(28)33-4,24(29)34-5)10-17(18)20(19)13-26/h6-9,17,20H,10-13H2,1-5H3 |
| InChIKey | GZFUDWUXEWJASX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|