C24H28O6 — CID 73407880
dimethyl 5-methyl-4-(phenylmethoxymethyl)-1,3,6,8,8a,8b-hexahydrocyclopenta[e][2]benzofuran-7,7-dicarboxylate (PubChem CID 73407880) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is dimethyl 5-methyl-4-(phenylmethoxymethyl)-1,3,6,8,8a,8b-hexahydrocyclopenta[e][2]benzofuran-7,7-dicarboxylate.
| Compound Name | dimethyl 5-methyl-4-(phenylmethoxymethyl)-1,3,6,8,8a,8b-hexahydrocyclopenta[e][2]benzofuran-7,7-dicarboxylate |
|---|---|
| PubChem CID | 73407880 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | dimethyl 5-methyl-4-(phenylmethoxymethyl)-1,3,6,8,8a,8b-hexahydrocyclopenta[e][2]benzofuran-7,7-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C(C)C(COCc3ccccc3)=C3COCC3C2C1 |
| InChI | InChI=1S/C24H28O6/c1-15-17-9-24(22(25)27-2,23(26)28-3)10-18(17)20-13-30-14-21(20)19(15)12-29-11-16-7-5-4-6-8-16/h4-8,18,20H,9-14H2,1-3H3 |
| InChIKey | ISYYPEAUUUJJOP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|