About 2-(2-oxo-2-pyrrolidin-1-ylethoxy)-N,N-diphenylacetamide
2-(2-oxo-2-pyrrolidin-1-ylethoxy)-N,N-diphenylacetamide (PubChem CID 7341013) has the molecular formula C20H22N2O3
and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-(2-oxo-2-pyrrolidin-1-ylethoxy)-N,N-diphenylacetamide.
Molecular Properties
| Compound Name | 2-(2-oxo-2-pyrrolidin-1-ylethoxy)-N,N-diphenylacetamide |
| PubChem CID | 7341013 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-(2-oxo-2-pyrrolidin-1-ylethoxy)-N,N-diphenylacetamide |
| SMILES | O=C(COCC(=O)N(c1ccccc1)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C20H22N2O3/c23-19(21-13-7-8-14-21)15-25-16-20(24)22(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2 |
| InChIKey | JAKWXMTXJCPPOU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-oxo-2-pyrrolidin-1-ylethoxy)-N,N-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxo-2-pyrrolidin-1-ylethoxy)-N,N-diphenylacetamide?
The IUPAC name of 2-(2-oxo-2-pyrrolidin-1-ylethoxy)-N,N-diphenylacetamide (CID 7341013) is 2-(2-oxo-2-pyrrolidin-1-ylethoxy)-N,N-diphenylacetamide.
What is the SMILES notation for 2-(2-oxo-2-pyrrolidin-1-ylethoxy)-N,N-diphenylacetamide?
The canonical SMILES for 2-(2-oxo-2-pyrrolidin-1-ylethoxy)-N,N-diphenylacetamide is O=C(COCC(=O)N(c1ccccc1)c1ccccc1)N1CCCC1.
What is the InChIKey of 2-(2-oxo-2-pyrrolidin-1-ylethoxy)-N,N-diphenylacetamide?
The InChIKey is JAKWXMTXJCPPOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O3/c23-19(21-13-7-8-14-21)15-25-16-20(24)22(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2.
What are the key properties of 2-(2-oxo-2-pyrrolidin-1-ylethoxy)-N,N-diphenylacetamide?
2-(2-oxo-2-pyrrolidin-1-ylethoxy)-N,N-diphenylacetamide has a molecular weight of 338.41 g/mol, XLogP of 2.99, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-2-pyrrolidin-1-ylethoxy)-N,N-diphenylacetamide is sourced from PubChem (CID 7341013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).