About 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoate
5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoate (PubChem CID 7341158) has the molecular formula C19H12F2NO3-
and a molecular weight of 340.31 g/mol. Its IUPAC name is 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoate.
Molecular Properties
| Compound Name | 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoate |
| PubChem CID | 7341158 |
| Molecular Formula | C19H12F2NO3- |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoate |
| SMILES | Cc1ccc(-c2ccc(/C=N/c3ccc(F)cc3F)o2)cc1C(=O)[O-] |
| InChI | InChI=1S/C19H13F2NO3/c1-11-2-3-12(8-15(11)19(23)24)18-7-5-14(25-18)10-22-17-6-4-13(20)9-16(17)21/h2-10H,1H3,(H,23,24)/p-1/b22-10+ |
| InChIKey | NHRMIDRVAMWEHU-LSHDLFTRSA-M |
| XLogP | 3.65 |
| TPSA | 65.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoate?
The IUPAC name of 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoate (CID 7341158) is 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoate.
What is the SMILES notation for 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoate?
The canonical SMILES for 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoate is Cc1ccc(-c2ccc(/C=N/c3ccc(F)cc3F)o2)cc1C(=O)[O-].
What is the InChIKey of 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoate?
The InChIKey is NHRMIDRVAMWEHU-LSHDLFTRSA-M. The full InChI is InChI=1S/C19H13F2NO3/c1-11-2-3-12(8-15(11)19(23)24)18-7-5-14(25-18)10-22-17-6-4-13(20)9-16(17)21/h2-10H,1H3,(H,23,24)/p-1/b22-10+.
What are the key properties of 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoate?
5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoate has a molecular weight of 340.31 g/mol, XLogP of 3.65, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[(2,4-difluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoate is sourced from PubChem (CID 7341158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).