About 4-(3-amino-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl)benzoic acid
4-(3-amino-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl)benzoic acid (PubChem CID 7341289) has the molecular formula C12H12N4O2
and a molecular weight of 244.25 g/mol. Its IUPAC name is 4-(3-amino-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl)benzoic acid.
Molecular Properties
| Compound Name | 4-(3-amino-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl)benzoic acid |
| PubChem CID | 7341289 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 4-(3-amino-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl)benzoic acid |
| SMILES | Nc1c2c(nn1-c1ccc(C(=O)O)cc1)CNC2 |
| InChI | InChI=1S/C12H12N4O2/c13-11-9-5-14-6-10(9)15-16(11)8-3-1-7(2-4-8)12(17)18/h1-4,14H,5-6,13H2,(H,17,18) |
| InChIKey | WSRDZTXUMFAXTJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3-amino-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-amino-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl)benzoic acid?
The IUPAC name of 4-(3-amino-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl)benzoic acid (CID 7341289) is 4-(3-amino-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl)benzoic acid.
What is the SMILES notation for 4-(3-amino-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl)benzoic acid?
The canonical SMILES for 4-(3-amino-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl)benzoic acid is Nc1c2c(nn1-c1ccc(C(=O)O)cc1)CNC2.
What is the InChIKey of 4-(3-amino-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl)benzoic acid?
The InChIKey is WSRDZTXUMFAXTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O2/c13-11-9-5-14-6-10(9)15-16(11)8-3-1-7(2-4-8)12(17)18/h1-4,14H,5-6,13H2,(H,17,18).
What are the key properties of 4-(3-amino-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl)benzoic acid?
4-(3-amino-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl)benzoic acid has a molecular weight of 244.25 g/mol, XLogP of 0.76, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-amino-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl)benzoic acid is sourced from PubChem (CID 7341289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).