About (4-propylphenyl) thiophene-2-carboxylate
(4-propylphenyl) thiophene-2-carboxylate (PubChem CID 734131) has the molecular formula C14H14O2S
and a molecular weight of 246.33 g/mol. Its IUPAC name is (4-propylphenyl) thiophene-2-carboxylate.
Molecular Properties
| Compound Name | (4-propylphenyl) thiophene-2-carboxylate |
| PubChem CID | 734131 |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | (4-propylphenyl) thiophene-2-carboxylate |
| SMILES | CCCc1ccc(OC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C14H14O2S/c1-2-4-11-6-8-12(9-7-11)16-14(15)13-5-3-10-17-13/h3,5-10H,2,4H2,1H3 |
| InChIKey | HLOUXCNVTAPNCB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-propylphenyl) thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propylphenyl) thiophene-2-carboxylate?
The IUPAC name of (4-propylphenyl) thiophene-2-carboxylate (CID 734131) is (4-propylphenyl) thiophene-2-carboxylate.
What is the SMILES notation for (4-propylphenyl) thiophene-2-carboxylate?
The canonical SMILES for (4-propylphenyl) thiophene-2-carboxylate is CCCc1ccc(OC(=O)c2cccs2)cc1.
What is the InChIKey of (4-propylphenyl) thiophene-2-carboxylate?
The InChIKey is HLOUXCNVTAPNCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2S/c1-2-4-11-6-8-12(9-7-11)16-14(15)13-5-3-10-17-13/h3,5-10H,2,4H2,1H3.
What are the key properties of (4-propylphenyl) thiophene-2-carboxylate?
(4-propylphenyl) thiophene-2-carboxylate has a molecular weight of 246.33 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propylphenyl) thiophene-2-carboxylate is sourced from PubChem (CID 734131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).