C9H5F3O — CID 73413418
3-(2,3,4-trifluorophenyl)prop-2-enal (PubChem CID 73413418) has the molecular formula C9H5F3O and a molecular weight of 186.13 g/mol. Its IUPAC name is 3-(2,3,4-trifluorophenyl)prop-2-enal.
| Compound Name | 3-(2,3,4-trifluorophenyl)prop-2-enal |
|---|---|
| PubChem CID | 73413418 |
| Molecular Formula | C9H5F3O |
| Molecular Weight | 186.13 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 3-(2,3,4-trifluorophenyl)prop-2-enal |
| SMILES | O=CC=Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C9H5F3O/c10-7-4-3-6(2-1-5-13)8(11)9(7)12/h1-5H |
| InChIKey | QITINNXPGLRJSG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.13 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|