About 4-(diethylamino)penta-2,4-dienal
4-(diethylamino)penta-2,4-dienal (PubChem CID 73413894) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 4-(diethylamino)penta-2,4-dienal.
Molecular Properties
| Compound Name | 4-(diethylamino)penta-2,4-dienal |
| PubChem CID | 73413894 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4-(diethylamino)penta-2,4-dienal |
| SMILES | C=C(C=CC=O)N(CC)CC |
| InChI | InChI=1S/C9H15NO/c1-4-10(5-2)9(3)7-6-8-11/h6-8H,3-5H2,1-2H3 |
| InChIKey | MGFUEBHEPIGBAF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethylamino)penta-2,4-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethylamino)penta-2,4-dienal?
The IUPAC name of 4-(diethylamino)penta-2,4-dienal (CID 73413894) is 4-(diethylamino)penta-2,4-dienal.
What is the SMILES notation for 4-(diethylamino)penta-2,4-dienal?
The canonical SMILES for 4-(diethylamino)penta-2,4-dienal is C=C(C=CC=O)N(CC)CC.
What is the InChIKey of 4-(diethylamino)penta-2,4-dienal?
The InChIKey is MGFUEBHEPIGBAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-4-10(5-2)9(3)7-6-8-11/h6-8H,3-5H2,1-2H3.
What are the key properties of 4-(diethylamino)penta-2,4-dienal?
4-(diethylamino)penta-2,4-dienal has a molecular weight of 153.22 g/mol, XLogP of 1.60, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethylamino)penta-2,4-dienal is sourced from PubChem (CID 73413894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).