C26H41BrNO4+ — CID 73416159
4-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-[2-[2-[(1R,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethoxy]ethyl]morpholin-4-ium (PubChem CID 73416159) has the molecular formula C26H41BrNO4+ and a molecular weight of 511.52 g/mol. Its IUPAC name is 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-[2-[2-[(1R,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethoxy]ethyl]morpholin-4-ium.
| Compound Name | 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-[2-[2-[(1R,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethoxy]ethyl]morpholin-4-ium |
|---|---|
| PubChem CID | 73416159 |
| Molecular Formula | C26H41BrNO4+ |
| Molecular Weight | 511.52 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-[2-[2-[(1R,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethoxy]ethyl]morpholin-4-ium |
| SMILES | COc1cc(Br)c(C[N+]2(CCOCC[C@H]3CC[C@H]4C[C@H]3C4(C)C)CCOCC2)cc1OC |
| InChI | InChI=1S/C26H41BrNO4/c1-26(2)21-6-5-19(22(26)16-21)7-11-31-12-8-28(9-13-32-14-10-28)18-20-15-24(29-3)25(30-4)17-23(20)27/h15,17,19,21-22H,5-14,16,18H2,1-4H3/q+1/t19-,21+,22-/m1/s1 |
| InChIKey | DDHUTBKXLWCZCO-BAGYTPMASA-N |
| XLogP | 5.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|