C19H21N3O2 — CID 73419908
N-[1-(1H-benzimidazol-2-yl)ethyl]-2-(2,6-dimethylphenoxy)acetamide (PubChem CID 73419908) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)ethyl]-2-(2,6-dimethylphenoxy)acetamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)ethyl]-2-(2,6-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 73419908 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)ethyl]-2-(2,6-dimethylphenoxy)acetamide |
| SMILES | Cc1cccc(C)c1OCC(=O)NC(C)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H21N3O2/c1-12-7-6-8-13(2)18(12)24-11-17(23)20-14(3)19-21-15-9-4-5-10-16(15)22-19/h4-10,14H,11H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | WGHURMCMZLXQBM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |