About (4-chloro-3-methylphenyl) (1S)-2,2-dibromo-1-methylcyclopropane-1-carboxylate
(4-chloro-3-methylphenyl) (1S)-2,2-dibromo-1-methylcyclopropane-1-carboxylate (PubChem CID 7342149) has the molecular formula C12H11Br2ClO2
and a molecular weight of 382.48 g/mol. Its IUPAC name is (4-chloro-3-methylphenyl) (1S)-2,2-dibromo-1-methylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | (4-chloro-3-methylphenyl) (1S)-2,2-dibromo-1-methylcyclopropane-1-carboxylate |
| PubChem CID | 7342149 |
| Molecular Formula | C12H11Br2ClO2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 379.88 |
| IUPAC Name | (4-chloro-3-methylphenyl) (1S)-2,2-dibromo-1-methylcyclopropane-1-carboxylate |
| SMILES | Cc1cc(OC(=O)[C@]2(C)CC2(Br)Br)ccc1Cl |
| InChI | InChI=1S/C12H11Br2ClO2/c1-7-5-8(3-4-9(7)15)17-10(16)11(2)6-12(11,13)14/h3-5H,6H2,1-2H3/t11-/m0/s1 |
| InChIKey | CEHDQTMVBOFKQK-NSHDSACASA-N |
| XLogP | 4.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-3-methylphenyl) (1S)-2,2-dibromo-1-methylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-3-methylphenyl) (1S)-2,2-dibromo-1-methylcyclopropane-1-carboxylate?
The IUPAC name of (4-chloro-3-methylphenyl) (1S)-2,2-dibromo-1-methylcyclopropane-1-carboxylate (CID 7342149) is (4-chloro-3-methylphenyl) (1S)-2,2-dibromo-1-methylcyclopropane-1-carboxylate.
What is the SMILES notation for (4-chloro-3-methylphenyl) (1S)-2,2-dibromo-1-methylcyclopropane-1-carboxylate?
The canonical SMILES for (4-chloro-3-methylphenyl) (1S)-2,2-dibromo-1-methylcyclopropane-1-carboxylate is Cc1cc(OC(=O)[C@]2(C)CC2(Br)Br)ccc1Cl.
What is the InChIKey of (4-chloro-3-methylphenyl) (1S)-2,2-dibromo-1-methylcyclopropane-1-carboxylate?
The InChIKey is CEHDQTMVBOFKQK-NSHDSACASA-N. The full InChI is InChI=1S/C12H11Br2ClO2/c1-7-5-8(3-4-9(7)15)17-10(16)11(2)6-12(11,13)14/h3-5H,6H2,1-2H3/t11-/m0/s1.
What are the key properties of (4-chloro-3-methylphenyl) (1S)-2,2-dibromo-1-methylcyclopropane-1-carboxylate?
(4-chloro-3-methylphenyl) (1S)-2,2-dibromo-1-methylcyclopropane-1-carboxylate has a molecular weight of 382.48 g/mol, XLogP of 4.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-3-methylphenyl) (1S)-2,2-dibromo-1-methylcyclopropane-1-carboxylate is sourced from PubChem (CID 7342149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).