2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid

C6H8N2O2S — CID 73424937

IUPAC2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid
SMILESCC(N)c1ncc(C(=O)O)s1
InChIInChI=1S/C6H8N2O2S/c1-3(7)5-8-2-4(11-5)6(9)10/h2-3H,7H2,1H3,(H,9,10)
InChIKeyZXTOHPCVEPZUIA-UHFFFAOYSA-N
MW172.21 g/mol
LogP0.86
Rot. Bonds2

About 2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid

2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 73424937) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is 2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid
PubChem CID73424937
Molecular FormulaC6H8N2O2S
Molecular Weight172.21 g/mol
Exact Mass172.03
IUPAC Name2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid
SMILESCC(N)c1ncc(C(=O)O)s1
InChIInChI=1S/C6H8N2O2S/c1-3(7)5-8-2-4(11-5)6(9)10/h2-3H,7H2,1H3,(H,9,10)
InChIKeyZXTOHPCVEPZUIA-UHFFFAOYSA-N
XLogP0.86
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.21
LogP ≤ 50.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid (CID 73424937) is 2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid is CC(N)c1ncc(C(=O)O)s1.
What is the InChIKey of 2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is ZXTOHPCVEPZUIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-3(7)5-8-2-4(11-5)6(9)10/h2-3H,7H2,1H3,(H,9,10).
What are the key properties of 2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid?
2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 172.21 g/mol, XLogP of 0.86, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminoethyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 73424937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).