C15H15FN2 — CID 73424977
2-(4-fluorophenyl)-1,2,3,4-tetrahydroquinolin-4-amine (PubChem CID 73424977) has the molecular formula C15H15FN2 and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1,2,3,4-tetrahydroquinolin-4-amine.
| Compound Name | 2-(4-fluorophenyl)-1,2,3,4-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 73424977 |
| Molecular Formula | C15H15FN2 |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-(4-fluorophenyl)-1,2,3,4-tetrahydroquinolin-4-amine |
| SMILES | NC1CC(c2ccc(F)cc2)Nc2ccccc21 |
| InChI | InChI=1S/C15H15FN2/c16-11-7-5-10(6-8-11)15-9-13(17)12-3-1-2-4-14(12)18-15/h1-8,13,15,18H,9,17H2 |
| InChIKey | VNIZSWIJALWKTP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |