About 3-(2-iodophenyl)oxetane
3-(2-iodophenyl)oxetane (PubChem CID 73425043) has the molecular formula C9H9IO
and a molecular weight of 260.07 g/mol. Its IUPAC name is 3-(2-iodophenyl)oxetane.
Molecular Properties
| Compound Name | 3-(2-iodophenyl)oxetane |
| PubChem CID | 73425043 |
| Molecular Formula | C9H9IO |
| Molecular Weight | 260.07 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | 3-(2-iodophenyl)oxetane |
| SMILES | Ic1ccccc1C1COC1 |
| InChI | InChI=1S/C9H9IO/c10-9-4-2-1-3-8(9)7-5-11-6-7/h1-4,7H,5-6H2 |
| InChIKey | JQOUDRSLCHNFTA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.07 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-iodophenyl)oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-iodophenyl)oxetane?
The IUPAC name of 3-(2-iodophenyl)oxetane (CID 73425043) is 3-(2-iodophenyl)oxetane.
What is the SMILES notation for 3-(2-iodophenyl)oxetane?
The canonical SMILES for 3-(2-iodophenyl)oxetane is Ic1ccccc1C1COC1.
What is the InChIKey of 3-(2-iodophenyl)oxetane?
The InChIKey is JQOUDRSLCHNFTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9IO/c10-9-4-2-1-3-8(9)7-5-11-6-7/h1-4,7H,5-6H2.
What are the key properties of 3-(2-iodophenyl)oxetane?
3-(2-iodophenyl)oxetane has a molecular weight of 260.07 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-iodophenyl)oxetane is sourced from PubChem (CID 73425043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).