C19H21N3O — CID 7342529
(7R)-2-(cyclopentylamino)-7-phenyl-7,8-dihydro-6H-quinazolin-5-one (PubChem CID 7342529) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is (7R)-2-(cyclopentylamino)-7-phenyl-7,8-dihydro-6H-quinazolin-5-one.
| Compound Name | (7R)-2-(cyclopentylamino)-7-phenyl-7,8-dihydro-6H-quinazolin-5-one |
|---|---|
| PubChem CID | 7342529 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (7R)-2-(cyclopentylamino)-7-phenyl-7,8-dihydro-6H-quinazolin-5-one |
| SMILES | O=C1C[C@H](c2ccccc2)Cc2nc(NC3CCCC3)ncc21 |
| InChI | InChI=1S/C19H21N3O/c23-18-11-14(13-6-2-1-3-7-13)10-17-16(18)12-20-19(22-17)21-15-8-4-5-9-15/h1-3,6-7,12,14-15H,4-5,8-11H2,(H,20,21,22)/t14-/m1/s1 |
| InChIKey | VSOCYTSVRVJJPD-CQSZACIVSA-N |
| XLogP | 3.74 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |