C19H18FN5O2 — CID 73425776
2-(3-fluorophenyl)-N-[4-[(2S)-morpholin-2-yl]phenyl]triazole-4-carboxamide (PubChem CID 73425776) has the molecular formula C19H18FN5O2 and a molecular weight of 367.38 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-[4-[(2S)-morpholin-2-yl]phenyl]triazole-4-carboxamide.
| Compound Name | 2-(3-fluorophenyl)-N-[4-[(2S)-morpholin-2-yl]phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 73425776 |
| Molecular Formula | C19H18FN5O2 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-(3-fluorophenyl)-N-[4-[(2S)-morpholin-2-yl]phenyl]triazole-4-carboxamide |
| SMILES | O=C(Nc1ccc([C@H]2CNCCO2)cc1)c1cnn(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C19H18FN5O2/c20-14-2-1-3-16(10-14)25-22-11-17(24-25)19(26)23-15-6-4-13(5-7-15)18-12-21-8-9-27-18/h1-7,10-11,18,21H,8-9,12H2,(H,23,26)/t18-/m1/s1 |
| InChIKey | GNXDYFHZZDWAEG-GOSISDBHSA-N |
| XLogP | 2.32 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |