C15H13N5S — CID 73425857
8,10-dimethyl-12-(6-methyl-3-pyridinyl)-5-thia-1,3,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 73425857) has the molecular formula C15H13N5S and a molecular weight of 295.37 g/mol. Its IUPAC name is 8,10-dimethyl-12-(6-methyl-3-pyridinyl)-5-thia-1,3,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 8,10-dimethyl-12-(6-methyl-3-pyridinyl)-5-thia-1,3,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 73425857 |
| Molecular Formula | C15H13N5S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 8,10-dimethyl-12-(6-methyl-3-pyridinyl)-5-thia-1,3,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | Cc1ccc(-c2nc(C)c3c(C)nc4scnc4n23)cn1 |
| InChI | InChI=1S/C15H13N5S/c1-8-4-5-11(6-16-8)13-18-9(2)12-10(3)19-15-14(20(12)13)17-7-21-15/h4-7H,1-3H3 |
| InChIKey | UHYHKBMUTNEOLE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |