C25H23F4N5O3 — CID 73425922
(E)-1-[(3aS,8aR)-2-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl]-3-[3-fluoro-4-(trifluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 73425922) has the molecular formula C25H23F4N5O3 and a molecular weight of 517.48 g/mol. Its IUPAC name is (E)-1-[(3aS,8aR)-2-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl]-3-[3-fluoro-4-(trifluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[(3aS,8aR)-2-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl]-3-[3-fluoro-4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 73425922 |
| Molecular Formula | C25H23F4N5O3 |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | (E)-1-[(3aS,8aR)-2-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl]-3-[3-fluoro-4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OC(F)(F)F)c(F)c1)N1CC[C@@H]2CN(C(=O)c3ccc4n[nH]nc4c3)C[C@@H]2CC1 |
| InChI | InChI=1S/C25H23F4N5O3/c26-19-11-15(1-5-22(19)37-25(27,28)29)2-6-23(35)33-9-7-17-13-34(14-18(17)8-10-33)24(36)16-3-4-20-21(12-16)31-32-30-20/h1-6,11-12,17-18H,7-10,13-14H2,(H,30,31,32)/b6-2+/t17-,18+ |
| InChIKey | DHPFCUFDSSGWBG-DEHXBRSFSA-N |
| XLogP | 4.02 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|